C21H28N4O2 — CID 176990368
1-[4-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 176990368) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[4-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 176990368 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-[4-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(CNCCCNc1cccnc1N)c1ccc(C2(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C21H28N4O2/c1-15(14-23-11-3-13-24-18-4-2-12-25-19(18)22)16-5-7-17(8-6-16)21(9-10-21)20(26)27/h2,4-8,12,15,23-24H,3,9-11,13-14H2,1H3,(H2,22,25)(H,26,27) |
| InChIKey | UVFCNSMSCGXMTH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|