C18H23N5 — CID 176990321
4-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]benzonitrile (PubChem CID 176990321) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]benzonitrile.
| Compound Name | 4-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 176990321 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]benzonitrile |
| SMILES | CC(CNCCCNc1cccnc1N)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H23N5/c1-14(16-7-5-15(12-19)6-8-16)13-21-9-3-11-22-17-4-2-10-23-18(17)20/h2,4-8,10,14,21-22H,3,9,11,13H2,1H3,(H2,20,23) |
| InChIKey | BTLOVRXCLHZWQB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|