C22H26N6 — CID 177174937
6-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]pyridine-3-carbonitrile;benzene (PubChem CID 177174937) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 6-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]pyridine-3-carbonitrile;benzene.
| Compound Name | 6-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]pyridine-3-carbonitrile;benzene |
|---|---|
| PubChem CID | 177174937 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 6-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]pyridine-3-carbonitrile;benzene |
| SMILES | N#Cc1ccc(CCNCCCNc2cccnc2N)nc1.c1ccccc1 |
| InChI | InChI=1S/C16H20N6.C6H6/c17-11-13-4-5-14(22-12-13)6-10-19-7-2-9-20-15-3-1-8-21-16(15)18;1-2-4-6-5-3-1/h1,3-5,8,12,19-20H,2,6-7,9-10H2,(H2,18,21);1-6H |
| InChIKey | ZWGSSEVRQPORBL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|