C24H29N5 — CID 176990253
benzene;4-[2-[3-[[2-(methylamino)-3-pyridinyl]amino]propylamino]ethyl]benzonitrile (PubChem CID 176990253) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is benzene;4-[2-[3-[[2-(methylamino)-3-pyridinyl]amino]propylamino]ethyl]benzonitrile.
| Compound Name | benzene;4-[2-[3-[[2-(methylamino)-3-pyridinyl]amino]propylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 176990253 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | benzene;4-[2-[3-[[2-(methylamino)-3-pyridinyl]amino]propylamino]ethyl]benzonitrile |
| SMILES | CNc1ncccc1NCCCNCCc1ccc(C#N)cc1.c1ccccc1 |
| InChI | InChI=1S/C18H23N5.C6H6/c1-20-18-17(4-2-11-23-18)22-12-3-10-21-13-9-15-5-7-16(14-19)8-6-15;1-2-4-6-5-3-1/h2,4-8,11,21-22H,3,9-10,12-13H2,1H3,(H,20,23);1-6H |
| InChIKey | SLYOGSGMIGIMMU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|