About 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene
2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene (PubChem CID 176990329) has the molecular formula C24H29N5
and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene.
Molecular Properties
| Compound Name | 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene |
| PubChem CID | 176990329 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene |
| SMILES | N#CCc1ccc(CCNCCCNc2cccnc2N)cc1.c1ccccc1 |
| InChI | InChI=1S/C18H23N5.C6H6/c19-10-8-15-4-6-16(7-5-15)9-14-21-11-2-13-22-17-3-1-12-23-18(17)20;1-2-4-6-5-3-1/h1,3-7,12,21-22H,2,8-9,11,13-14H2,(H2,20,23);1-6H |
| InChIKey | OTWOIXWSMDBXDB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene?
The IUPAC name of 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene (CID 176990329) is 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene.
What is the SMILES notation for 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene?
The canonical SMILES for 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene is N#CCc1ccc(CCNCCCNc2cccnc2N)cc1.c1ccccc1.
What is the InChIKey of 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene?
The InChIKey is OTWOIXWSMDBXDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5.C6H6/c19-10-8-15-4-6-16(7-5-15)9-14-21-11-2-13-22-17-3-1-12-23-18(17)20;1-2-4-6-5-3-1/h1,3-7,12,21-22H,2,8-9,11,13-14H2,(H2,20,23);1-6H.
What are the key properties of 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene?
2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene has a molecular weight of 387.53 g/mol, XLogP of 4.05, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]acetonitrile;benzene is sourced from PubChem (CID 176990329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).