C23H29FN4O2 — CID 177174834
2-[3-[1-[3-(2-amino-3-cyano-5-fluoroanilino)propylamino]propan-2-yl]phenyl]-2-methylpropanoic acid (PubChem CID 177174834) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[3-[1-[3-(2-amino-3-cyano-5-fluoroanilino)propylamino]propan-2-yl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-[1-[3-(2-amino-3-cyano-5-fluoroanilino)propylamino]propan-2-yl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 177174834 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 2-[3-[1-[3-(2-amino-3-cyano-5-fluoroanilino)propylamino]propan-2-yl]phenyl]-2-methylpropanoic acid |
| SMILES | CC(CNCCCNc1cc(F)cc(C#N)c1N)c1cccc(C(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C23H29FN4O2/c1-15(16-6-4-7-18(10-16)23(2,3)22(29)30)14-27-8-5-9-28-20-12-19(24)11-17(13-25)21(20)26/h4,6-7,10-12,15,27-28H,5,8-9,14,26H2,1-3H3,(H,29,30) |
| InChIKey | FIECRODCSZAKAD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|