C21H26N2O6 — CID 177176255
methyl 2-(aminomethyl)-5-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]pyridine-4-carboxylate (PubChem CID 177176255) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-5-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]pyridine-4-carboxylate.
| Compound Name | methyl 2-(aminomethyl)-5-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 177176255 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | methyl 2-(aminomethyl)-5-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(CN)ncc1Oc1ccc(OCCOC2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26N2O6/c1-25-21(24)19-12-15(13-22)23-14-20(19)29-18-4-2-16(3-5-18)27-10-11-28-17-6-8-26-9-7-17/h2-5,12,14,17H,6-11,13,22H2,1H3 |
| InChIKey | YVVLXHYTBAULLL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|