C24H26N2O5 — CID 66730470
ethyl 8-[4-[2-(oxan-4-yloxy)ethoxy]phenyl]-1,6-naphthyridine-2-carboxylate (PubChem CID 66730470) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is ethyl 8-[4-[2-(oxan-4-yloxy)ethoxy]phenyl]-1,6-naphthyridine-2-carboxylate.
| Compound Name | ethyl 8-[4-[2-(oxan-4-yloxy)ethoxy]phenyl]-1,6-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 66730470 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethyl 8-[4-[2-(oxan-4-yloxy)ethoxy]phenyl]-1,6-naphthyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2cncc(-c3ccc(OCCOC4CCOCC4)cc3)c2n1 |
| InChI | InChI=1S/C24H26N2O5/c1-2-29-24(27)22-8-5-18-15-25-16-21(23(18)26-22)17-3-6-19(7-4-17)30-13-14-31-20-9-11-28-12-10-20/h3-8,15-16,20H,2,9-14H2,1H3 |
| InChIKey | IKOKRPCXWBNXCE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|