C22H25N3O5 — CID 177176588
6-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]-1-(trideuteriomethyl)indazole-5-carboxamide (PubChem CID 177176588) has the molecular formula C22H25N3O5 and a molecular weight of 414.48 g/mol. Its IUPAC name is 6-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]-1-(trideuteriomethyl)indazole-5-carboxamide.
| Compound Name | 6-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]-1-(trideuteriomethyl)indazole-5-carboxamide |
|---|---|
| PubChem CID | 177176588 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 6-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]-1-(trideuteriomethyl)indazole-5-carboxamide |
| SMILES | [2H]C([2H])([2H])n1ncc2cc(C(N)=O)c(Oc3ccc(OCCOC4CCOCC4)cc3)cc21 |
| InChI | InChI=1S/C22H25N3O5/c1-25-20-13-21(19(22(23)26)12-15(20)14-24-25)30-18-4-2-16(3-5-18)28-10-11-29-17-6-8-27-9-7-17/h2-5,12-14,17H,6-11H2,1H3,(H2,23,26)/i1D3 |
| InChIKey | BZTAYYXIZSSJSN-FIBGUPNXSA-N |
| XLogP | 3.04 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|