C23H24N4O5 — CID 177176687
6-[4-[2-[(3-hydroxybicyclo[1.1.1]pentane-1-carbonyl)amino]ethoxy]phenoxy]-1-methylindazole-5-carboxamide (PubChem CID 177176687) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 6-[4-[2-[(3-hydroxybicyclo[1.1.1]pentane-1-carbonyl)amino]ethoxy]phenoxy]-1-methylindazole-5-carboxamide.
| Compound Name | 6-[4-[2-[(3-hydroxybicyclo[1.1.1]pentane-1-carbonyl)amino]ethoxy]phenoxy]-1-methylindazole-5-carboxamide |
|---|---|
| PubChem CID | 177176687 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 6-[4-[2-[(3-hydroxybicyclo[1.1.1]pentane-1-carbonyl)amino]ethoxy]phenoxy]-1-methylindazole-5-carboxamide |
| SMILES | Cn1ncc2cc(C(N)=O)c(Oc3ccc(OCCNC(=O)C45CC(O)(C4)C5)cc3)cc21 |
| InChI | InChI=1S/C23H24N4O5/c1-27-18-9-19(17(20(24)28)8-14(18)10-26-27)32-16-4-2-15(3-5-16)31-7-6-25-21(29)22-11-23(30,12-22)13-22/h2-5,8-10,30H,6-7,11-13H2,1H3,(H2,24,28)(H,25,29) |
| InChIKey | PSDAJLOYCIGJII-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|