C23H27N5O4 — CID 177176324
1-methyl-7-[4-[3-(4-methyl-2-oxopiperazin-1-yl)propoxy]phenoxy]indazole-5-carboxamide (PubChem CID 177176324) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-methyl-7-[4-[3-(4-methyl-2-oxopiperazin-1-yl)propoxy]phenoxy]indazole-5-carboxamide.
| Compound Name | 1-methyl-7-[4-[3-(4-methyl-2-oxopiperazin-1-yl)propoxy]phenoxy]indazole-5-carboxamide |
|---|---|
| PubChem CID | 177176324 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-methyl-7-[4-[3-(4-methyl-2-oxopiperazin-1-yl)propoxy]phenoxy]indazole-5-carboxamide |
| SMILES | CN1CCN(CCCOc2ccc(Oc3cc(C(N)=O)cc4cnn(C)c34)cc2)C(=O)C1 |
| InChI | InChI=1S/C23H27N5O4/c1-26-9-10-28(21(29)15-26)8-3-11-31-18-4-6-19(7-5-18)32-20-13-16(23(24)30)12-17-14-25-27(2)22(17)20/h4-7,12-14H,3,8-11,15H2,1-2H3,(H2,24,30) |
| InChIKey | KBPQXLUKXIRSHP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|