About 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide
1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide (PubChem CID 177176744) has the molecular formula C19H18N6O3
and a molecular weight of 378.39 g/mol. Its IUPAC name is 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide |
| PubChem CID | 177176744 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide |
| SMILES | Cn1ncc2cc(C(N)=O)cc(Oc3ccc(OCCn4cnnc4)cc3)c21 |
| InChI | InChI=1S/C19H18N6O3/c1-24-18-14(10-23-24)8-13(19(20)26)9-17(18)28-16-4-2-15(3-5-16)27-7-6-25-11-21-22-12-25/h2-5,8-12H,6-7H2,1H3,(H2,20,26) |
| InChIKey | YOLNFPKDBBDEBR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide?
The IUPAC name of 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide (CID 177176744) is 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide.
What is the SMILES notation for 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide?
The canonical SMILES for 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide is Cn1ncc2cc(C(N)=O)cc(Oc3ccc(OCCn4cnnc4)cc3)c21.
What is the InChIKey of 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide?
The InChIKey is YOLNFPKDBBDEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N6O3/c1-24-18-14(10-23-24)8-13(19(20)26)9-17(18)28-16-4-2-15(3-5-16)27-7-6-25-11-21-22-12-25/h2-5,8-12H,6-7H2,1H3,(H2,20,26).
What are the key properties of 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide?
1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide has a molecular weight of 378.39 g/mol, XLogP of 2.13, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-[4-[2-(1,2,4-triazol-4-yl)ethoxy]phenoxy]indazole-5-carboxamide is sourced from PubChem (CID 177176744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).