About 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide
7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide (PubChem CID 177176752) has the molecular formula C22H24F2N4O4
and a molecular weight of 446.45 g/mol. Its IUPAC name is 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide.
Molecular Properties
| Compound Name | 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide |
| PubChem CID | 177176752 |
| Molecular Formula | C22H24F2N4O4 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide |
| SMILES | Cn1ncc2cc(C(N)=O)cc(Oc3ccc(OCC(F)(F)CN4CCOCC4)cc3)c21 |
| InChI | InChI=1S/C22H24F2N4O4/c1-27-20-16(12-26-27)10-15(21(25)29)11-19(20)32-18-4-2-17(3-5-18)31-14-22(23,24)13-28-6-8-30-9-7-28/h2-5,10-12H,6-9,13-14H2,1H3,(H2,25,29) |
| InChIKey | WCOVAJMXRUDAFB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide?
The IUPAC name of 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide (CID 177176752) is 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide.
What is the SMILES notation for 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide?
The canonical SMILES for 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide is Cn1ncc2cc(C(N)=O)cc(Oc3ccc(OCC(F)(F)CN4CCOCC4)cc3)c21.
What is the InChIKey of 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide?
The InChIKey is WCOVAJMXRUDAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24F2N4O4/c1-27-20-16(12-26-27)10-15(21(25)29)11-19(20)32-18-4-2-17(3-5-18)31-14-22(23,24)13-28-6-8-30-9-7-28/h2-5,10-12H,6-9,13-14H2,1H3,(H2,25,29).
What are the key properties of 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide?
7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide has a molecular weight of 446.45 g/mol, XLogP of 2.81, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-(2,2-difluoro-3-morpholin-4-ylpropoxy)phenoxy]-1-methylindazole-5-carboxamide is sourced from PubChem (CID 177176752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).