C22H23FN4O5 — CID 177176599
6-[2-fluoro-4-(3-morpholin-4-yl-3-oxopropoxy)phenoxy]-1-methylindazole-5-carboxamide (PubChem CID 177176599) has the molecular formula C22H23FN4O5 and a molecular weight of 442.45 g/mol. Its IUPAC name is 6-[2-fluoro-4-(3-morpholin-4-yl-3-oxopropoxy)phenoxy]-1-methylindazole-5-carboxamide.
| Compound Name | 6-[2-fluoro-4-(3-morpholin-4-yl-3-oxopropoxy)phenoxy]-1-methylindazole-5-carboxamide |
|---|---|
| PubChem CID | 177176599 |
| Molecular Formula | C22H23FN4O5 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 6-[2-fluoro-4-(3-morpholin-4-yl-3-oxopropoxy)phenoxy]-1-methylindazole-5-carboxamide |
| SMILES | Cn1ncc2cc(C(N)=O)c(Oc3ccc(OCCC(=O)N4CCOCC4)cc3F)cc21 |
| InChI | InChI=1S/C22H23FN4O5/c1-26-18-12-20(16(22(24)29)10-14(18)13-25-26)32-19-3-2-15(11-17(19)23)31-7-4-21(28)27-5-8-30-9-6-27/h2-3,10-13H,4-9H2,1H3,(H2,24,29) |
| InChIKey | YTMJLXUBOJBINP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |