C23H27N3O5 — CID 177176510
1-ethyl-6-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]indazole-5-carboxamide (PubChem CID 177176510) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 1-ethyl-6-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]indazole-5-carboxamide.
| Compound Name | 1-ethyl-6-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]indazole-5-carboxamide |
|---|---|
| PubChem CID | 177176510 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-ethyl-6-[4-[2-(oxan-4-yloxy)ethoxy]phenoxy]indazole-5-carboxamide |
| SMILES | CCn1ncc2cc(C(N)=O)c(Oc3ccc(OCCOC4CCOCC4)cc3)cc21 |
| InChI | InChI=1S/C23H27N3O5/c1-2-26-21-14-22(20(23(24)27)13-16(21)15-25-26)31-19-5-3-17(4-6-19)29-11-12-30-18-7-9-28-10-8-18/h3-6,13-15,18H,2,7-12H2,1H3,(H2,24,27) |
| InChIKey | ZOOZYCJWVDXJRS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|