C11H13N2Rb — CID 177176406
6,7-diethyl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) (PubChem CID 177176406) has the molecular formula C11H13N2Rb and a molecular weight of 258.71 g/mol. Its IUPAC name is 6,7-diethyl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+).
| Compound Name | 6,7-diethyl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) |
|---|---|
| PubChem CID | 177176406 |
| Molecular Formula | C11H13N2Rb |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 6,7-diethyl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) |
| SMILES | CCc1cc2cn[c-]n2cc1CC.[Rb+] |
| InChI | InChI=1S/C11H13N2.Rb/c1-3-9-5-11-6-12-8-13(11)7-10(9)4-2;/h5-7H,3-4H2,1-2H3;/q-1;+1 |
| InChIKey | OIWLQCXKSGHELE-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|