C13H17N2Rb — CID 177176727
5,7-di(propan-2-yl)-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) (PubChem CID 177176727) has the molecular formula C13H17N2Rb and a molecular weight of 286.76 g/mol. Its IUPAC name is 5,7-di(propan-2-yl)-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+).
| Compound Name | 5,7-di(propan-2-yl)-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) |
|---|---|
| PubChem CID | 177176727 |
| Molecular Formula | C13H17N2Rb |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5,7-di(propan-2-yl)-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) |
| SMILES | CC(C)c1cc(C(C)C)n2[c-]ncc2c1.[Rb+] |
| InChI | InChI=1S/C13H17N2.Rb/c1-9(2)11-5-12-7-14-8-15(12)13(6-11)10(3)4;/h5-7,9-10H,1-4H3;/q-1;+1 |
| InChIKey | LFFBCSXTPKFMSL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|