About 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)
5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) (PubChem CID 177176418) has the molecular formula C12H15N2Rb
and a molecular weight of 272.73 g/mol. Its IUPAC name is 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+).
Molecular Properties
| Compound Name | 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) |
| PubChem CID | 177176418 |
| Molecular Formula | C12H15N2Rb |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) |
| SMILES | CCc1cc(C(C)C)cc2cn[c-]n12.[Rb+] |
| InChI | InChI=1S/C12H15N2.Rb/c1-4-11-5-10(9(2)3)6-12-7-13-8-14(11)12;/h5-7,9H,4H2,1-3H3;/q-1;+1 |
| InChIKey | ISFUDVGDPNIQKD-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)?
The IUPAC name of 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) (CID 177176418) is 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+).
What is the SMILES notation for 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)?
The canonical SMILES for 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) is CCc1cc(C(C)C)cc2cn[c-]n12.[Rb+].
What is the InChIKey of 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)?
The InChIKey is ISFUDVGDPNIQKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N2.Rb/c1-4-11-5-10(9(2)3)6-12-7-13-8-14(11)12;/h5-7,9H,4H2,1-3H3;/q-1;+1.
What are the key properties of 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)?
5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) has a molecular weight of 272.73 g/mol, XLogP of -0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) is sourced from PubChem (CID 177176418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).