About methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)
methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) (PubChem CID 177176640) has the molecular formula C12H17N2Rb
and a molecular weight of 274.75 g/mol. Its IUPAC name is methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+).
Molecular Properties
| Compound Name | methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) |
| PubChem CID | 177176640 |
| Molecular Formula | C12H17N2Rb |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) |
| SMILES | C.Cc1cc(C(C)C)cc2cn[c-]n12.[Rb+] |
| InChI | InChI=1S/C11H13N2.CH4.Rb/c1-8(2)10-4-9(3)13-7-12-6-11(13)5-10;;/h4-6,8H,1-3H3;1H4;/q-1;;+1 |
| InChIKey | AHZRNCVAJVHFCQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)?
The IUPAC name of methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) (CID 177176640) is methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+).
What is the SMILES notation for methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)?
The canonical SMILES for methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) is C.Cc1cc(C(C)C)cc2cn[c-]n12.[Rb+].
What is the InChIKey of methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)?
The InChIKey is AHZRNCVAJVHFCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N2.CH4.Rb/c1-8(2)10-4-9(3)13-7-12-6-11(13)5-10;;/h4-6,8H,1-3H3;1H4;/q-1;;+1.
What are the key properties of methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+)?
methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) has a molecular weight of 274.75 g/mol, XLogP of 0.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-methyl-7-propan-2-yl-3H-imidazo[1,5-a]pyridin-3-ide;rubidium(1+) is sourced from PubChem (CID 177176640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).