C18H28N2O3 — CID 177177407
N-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-3-(1-formylpyrrolidin-2-yl)-3-methoxypropanamide (PubChem CID 177177407) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is N-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-3-(1-formylpyrrolidin-2-yl)-3-methoxypropanamide.
| Compound Name | N-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-3-(1-formylpyrrolidin-2-yl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 177177407 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-3-(1-formylpyrrolidin-2-yl)-3-methoxypropanamide |
| SMILES | C=C/C=C\C(=C/C)CCNC(=O)CC(OC)C1CCCN1C=O |
| InChI | InChI=1S/C18H28N2O3/c1-4-6-8-15(5-2)10-11-19-18(22)13-17(23-3)16-9-7-12-20(16)14-21/h4-6,8,14,16-17H,1,7,9-13H2,2-3H3,(H,19,22)/b8-6-,15-5+ |
| InChIKey | WAZIOVZSHITCKC-VWZXJCOGSA-N |
| XLogP | 2.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|