About 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene
1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene (PubChem CID 177178951) has the molecular formula C18H22Cl2
and a molecular weight of 309.28 g/mol. Its IUPAC name is 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene.
Molecular Properties
| Compound Name | 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene |
| PubChem CID | 177178951 |
| Molecular Formula | C18H22Cl2 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene |
| SMILES | CC(C)c1cccc(Cl)c1.CCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/2C9H11Cl/c1-7(2)8-4-3-5-9(10)6-8;1-2-3-8-4-6-9(10)7-5-8/h3-7H,1-2H3;4-7H,2-3H2,1H3 |
| InChIKey | GTKADCRTZUSHGY-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene?
The IUPAC name of 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene (CID 177178951) is 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene.
What is the SMILES notation for 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene?
The canonical SMILES for 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene is CC(C)c1cccc(Cl)c1.CCCc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene?
The InChIKey is GTKADCRTZUSHGY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11Cl/c1-7(2)8-4-3-5-9(10)6-8;1-2-3-8-4-6-9(10)7-5-8/h3-7H,1-2H3;4-7H,2-3H2,1H3.
What are the key properties of 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene?
1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene has a molecular weight of 309.28 g/mol, XLogP of 6.76, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-propan-2-ylbenzene;1-chloro-4-propylbenzene is sourced from PubChem (CID 177178951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).