C16H18Cl2N2 — CID 91267468
1-[1-(3-chlorophenyl)-2-(4-chlorophenyl)ethyl]-2-ethylhydrazine (PubChem CID 91267468) has the molecular formula C16H18Cl2N2 and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-2-(4-chlorophenyl)ethyl]-2-ethylhydrazine.
| Compound Name | 1-[1-(3-chlorophenyl)-2-(4-chlorophenyl)ethyl]-2-ethylhydrazine |
|---|---|
| PubChem CID | 91267468 |
| Molecular Formula | C16H18Cl2N2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-2-(4-chlorophenyl)ethyl]-2-ethylhydrazine |
| SMILES | CCNNC(Cc1ccc(Cl)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N2/c1-2-19-20-16(13-4-3-5-15(18)11-13)10-12-6-8-14(17)9-7-12/h3-9,11,16,19-20H,2,10H2,1H3 |
| InChIKey | DFSRYXHJNCQZEO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|