C25H26N2O — CID 177181754
[(1S,3S,4S)-5-trityl-2,5-diazabicyclo[2.2.1]heptan-3-yl]methanol (PubChem CID 177181754) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is [(1S,3S,4S)-5-trityl-2,5-diazabicyclo[2.2.1]heptan-3-yl]methanol.
| Compound Name | [(1S,3S,4S)-5-trityl-2,5-diazabicyclo[2.2.1]heptan-3-yl]methanol |
|---|---|
| PubChem CID | 177181754 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(1S,3S,4S)-5-trityl-2,5-diazabicyclo[2.2.1]heptan-3-yl]methanol |
| SMILES | OC[C@H]1N[C@H]2C[C@@H]1N(C(c1ccccc1)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C25H26N2O/c28-18-23-24-16-22(26-23)17-27(24)25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,22-24,26,28H,16-18H2/t22-,23+,24-/m0/s1 |
| InChIKey | DCQPJFXKZXHGJC-VXNXHJTFSA-N |
| XLogP | 3.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|