C25H26N4O4 — CID 177188179
N-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]-3-propyl-1H-indole-2-carboxamide (PubChem CID 177188179) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]-3-propyl-1H-indole-2-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]-3-propyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 177188179 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]-3-propyl-1H-indole-2-carboxamide |
| SMILES | CCCc1c(C(=O)Nc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3O)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H26N4O4/c1-2-5-18-17-6-3-4-7-19(17)27-22(18)24(32)26-15-8-9-16-14(12-15)13-29(25(16)33)20-10-11-21(30)28-23(20)31/h3-4,6-9,12,20,25,27,33H,2,5,10-11,13H2,1H3,(H,26,32)(H,28,30,31) |
| InChIKey | GYMQYSOPFWOELR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|