About 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane
1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane (PubChem CID 177195101) has the molecular formula C19H20BrN3OS
and a molecular weight of 418.36 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane |
| PubChem CID | 177195101 |
| Molecular Formula | C19H20BrN3OS |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane |
| SMILES | CC.O=C(Nc1ccc(Br)cc1)Nc1nc2c(C3CC3)cccc2s1 |
| InChI | InChI=1S/C17H14BrN3OS.C2H6/c18-11-6-8-12(9-7-11)19-16(22)21-17-20-15-13(10-4-5-10)2-1-3-14(15)23-17;1-2/h1-3,6-10H,4-5H2,(H2,19,20,21,22);1-2H3 |
| InChIKey | DLQFBCOIJMPVMI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane?
The IUPAC name of 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane (CID 177195101) is 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane.
What is the SMILES notation for 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane?
The canonical SMILES for 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane is CC.O=C(Nc1ccc(Br)cc1)Nc1nc2c(C3CC3)cccc2s1.
What is the InChIKey of 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane?
The InChIKey is DLQFBCOIJMPVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN3OS.C2H6/c18-11-6-8-12(9-7-11)19-16(22)21-17-20-15-13(10-4-5-10)2-1-3-14(15)23-17;1-2/h1-3,6-10H,4-5H2,(H2,19,20,21,22);1-2H3.
What are the key properties of 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane?
1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane has a molecular weight of 418.36 g/mol, XLogP of 6.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3-(4-cyclopropyl-1,3-benzothiazol-2-yl)urea;ethane is sourced from PubChem (CID 177195101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).