C16H11N3O4 — CID 177195365
2-(3,5-diamino-1-benzofuran-2-yl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 177195365) has the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-(3,5-diamino-1-benzofuran-2-yl)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(3,5-diamino-1-benzofuran-2-yl)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 177195365 |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-(3,5-diamino-1-benzofuran-2-yl)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | Nc1ccc2oc(-c3nc4ccc(C(=O)O)cc4o3)c(N)c2c1 |
| InChI | InChI=1S/C16H11N3O4/c17-8-2-4-11-9(6-8)13(18)14(22-11)15-19-10-3-1-7(16(20)21)5-12(10)23-15/h1-6H,17-18H2,(H,20,21) |
| InChIKey | DEGXPYVZXVRWBZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|