C27H31N7O2S — CID 177195378
6-(1,7-diazaspiro[3.5]nonan-7-yl)-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine (PubChem CID 177195378) has the molecular formula C27H31N7O2S and a molecular weight of 517.66 g/mol. Its IUPAC name is 6-(1,7-diazaspiro[3.5]nonan-7-yl)-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine.
| Compound Name | 6-(1,7-diazaspiro[3.5]nonan-7-yl)-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine |
|---|---|
| PubChem CID | 177195378 |
| Molecular Formula | C27H31N7O2S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 6-(1,7-diazaspiro[3.5]nonan-7-yl)-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine |
| SMILES | COc1ccc(C)c(Oc2nc(N3CCC4(CCN4)CC3)cc3c(-c4nnc(C)s4)cnc(N)c23)c1C |
| InChI | InChI=1S/C27H31N7O2S/c1-15-5-6-20(35-4)16(2)23(15)36-25-22-18(19(14-29-24(22)28)26-33-32-17(3)37-26)13-21(31-25)34-11-8-27(9-12-34)7-10-30-27/h5-6,13-14,30H,7-12H2,1-4H3,(H2,28,29) |
| InChIKey | OVHJFSYBSKRODZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |