C32H33ClN6O5S — CID 177195434
6-chloro-N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine (PubChem CID 177195434) has the molecular formula C32H33ClN6O5S and a molecular weight of 649.17 g/mol. Its IUPAC name is 6-chloro-N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine.
| Compound Name | 6-chloro-N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine |
|---|---|
| PubChem CID | 177195434 |
| Molecular Formula | C32H33ClN6O5S |
| Molecular Weight | 649.17 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | 6-chloro-N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine |
| SMILES | COc1ccc(CNc2ncc(-c3nnc(N4CCOCC4)s3)c3cc(Cl)nc(Oc4c(C)ccc(OC)c4C)c23)c(OC)c1 |
| InChI | InChI=1S/C32H33ClN6O5S/c1-18-6-9-24(41-4)19(2)28(18)44-30-27-22(15-26(33)36-30)23(31-37-38-32(45-31)39-10-12-43-13-11-39)17-35-29(27)34-16-20-7-8-21(40-3)14-25(20)42-5/h6-9,14-15,17H,10-13,16H2,1-5H3,(H,34,35) |
| InChIKey | LYJSITUZSWLQMG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.17 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|