C26H29N7O2S — CID 177195395
3-[[8-amino-3-(1,7-diazaspiro[3.5]nonan-7-yl)-5-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-yl]oxy]-2,4-dimethylphenol (PubChem CID 177195395) has the molecular formula C26H29N7O2S and a molecular weight of 503.63 g/mol. Its IUPAC name is 3-[[8-amino-3-(1,7-diazaspiro[3.5]nonan-7-yl)-5-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-yl]oxy]-2,4-dimethylphenol.
| Compound Name | 3-[[8-amino-3-(1,7-diazaspiro[3.5]nonan-7-yl)-5-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-yl]oxy]-2,4-dimethylphenol |
|---|---|
| PubChem CID | 177195395 |
| Molecular Formula | C26H29N7O2S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 3-[[8-amino-3-(1,7-diazaspiro[3.5]nonan-7-yl)-5-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-yl]oxy]-2,4-dimethylphenol |
| SMILES | Cc1nnc(-c2cnc(N)c3c(Oc4c(C)ccc(O)c4C)nc(N4CCC5(CCN5)CC4)cc23)s1 |
| InChI | InChI=1S/C26H29N7O2S/c1-14-4-5-19(34)15(2)22(14)35-24-21-17(18(13-28-23(21)27)25-32-31-16(3)36-25)12-20(30-24)33-10-7-26(8-11-33)6-9-29-26/h4-5,12-13,29,34H,6-11H2,1-3H3,(H2,27,28) |
| InChIKey | FMZSSTKPDKKWDX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |