C36H41N7O4S — CID 177195472
6-(1,7-diazaspiro[3.5]nonan-7-yl)-N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine (PubChem CID 177195472) has the molecular formula C36H41N7O4S and a molecular weight of 667.84 g/mol. Its IUPAC name is 6-(1,7-diazaspiro[3.5]nonan-7-yl)-N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine.
| Compound Name | 6-(1,7-diazaspiro[3.5]nonan-7-yl)-N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine |
|---|---|
| PubChem CID | 177195472 |
| Molecular Formula | C36H41N7O4S |
| Molecular Weight | 667.84 g/mol |
| Exact Mass | 667.29 |
| IUPAC Name | 6-(1,7-diazaspiro[3.5]nonan-7-yl)-N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine |
| SMILES | COc1ccc(CNc2ncc(-c3nnc(C)s3)c3cc(N4CCC5(CCN5)CC4)nc(Oc4c(C)ccc(OC)c4C)c23)c(OC)c1 |
| InChI | InChI=1S/C36H41N7O4S/c1-21-7-10-28(45-5)22(2)32(21)47-34-31-26(18-30(40-34)43-15-12-36(13-16-43)11-14-39-36)27(35-42-41-23(3)48-35)20-38-33(31)37-19-24-8-9-25(44-4)17-29(24)46-6/h7-10,17-18,20,39H,11-16,19H2,1-6H3,(H,37,38) |
| InChIKey | SDPNGAVCWUOGTD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.84 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |