C19H16ClN5O2S — CID 177195439
3-[[8-amino-3-chloro-5-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-yl]oxy]-2,4-dimethylphenol (PubChem CID 177195439) has the molecular formula C19H16ClN5O2S and a molecular weight of 413.89 g/mol. Its IUPAC name is 3-[[8-amino-3-chloro-5-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-yl]oxy]-2,4-dimethylphenol.
| Compound Name | 3-[[8-amino-3-chloro-5-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-yl]oxy]-2,4-dimethylphenol |
|---|---|
| PubChem CID | 177195439 |
| Molecular Formula | C19H16ClN5O2S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3-[[8-amino-3-chloro-5-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-yl]oxy]-2,4-dimethylphenol |
| SMILES | Cc1nnc(-c2cnc(N)c3c(Oc4c(C)ccc(O)c4C)nc(Cl)cc23)s1 |
| InChI | InChI=1S/C19H16ClN5O2S/c1-8-4-5-13(26)9(2)16(8)27-18-15-11(6-14(20)23-18)12(7-22-17(15)21)19-25-24-10(3)28-19/h4-7,26H,1-3H3,(H2,21,22) |
| InChIKey | ZPCRHJBDXLZRSQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|