C9H12N4 — CID 177202448
N,2,8-trimethylimidazo[1,2-b]pyridazin-6-amine (PubChem CID 177202448) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is N,2,8-trimethylimidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N,2,8-trimethylimidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 177202448 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | N,2,8-trimethylimidazo[1,2-b]pyridazin-6-amine |
| SMILES | CNc1cc(C)c2nc(C)cn2n1 |
| InChI | InChI=1S/C9H12N4/c1-6-4-8(10-3)12-13-5-7(2)11-9(6)13/h4-5H,1-3H3,(H,10,12) |
| InChIKey | HNCZMAZZDKYOHH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |