C12H19N3 — CID 167500307
ethane;8-ethyl-2,6-dimethylimidazo[1,2-b]pyridazine (PubChem CID 167500307) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;8-ethyl-2,6-dimethylimidazo[1,2-b]pyridazine.
| Compound Name | ethane;8-ethyl-2,6-dimethylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 167500307 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | ethane;8-ethyl-2,6-dimethylimidazo[1,2-b]pyridazine |
| SMILES | CC.CCc1cc(C)nn2cc(C)nc12 |
| InChI | InChI=1S/C10H13N3.C2H6/c1-4-9-5-7(2)12-13-6-8(3)11-10(9)13;1-2/h5-6H,4H2,1-3H3;1-2H3 |
| InChIKey | CPODMWCGHNBXHX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |