C21H18N4 — CID 139514170
N-(2,6-dimethylimidazo[1,2-b]pyridazin-8-yl)-1,1-diphenylmethanimine (PubChem CID 139514170) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(2,6-dimethylimidazo[1,2-b]pyridazin-8-yl)-1,1-diphenylmethanimine.
| Compound Name | N-(2,6-dimethylimidazo[1,2-b]pyridazin-8-yl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 139514170 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-(2,6-dimethylimidazo[1,2-b]pyridazin-8-yl)-1,1-diphenylmethanimine |
| SMILES | Cc1cn2nc(C)cc(N=C(c3ccccc3)c3ccccc3)c2n1 |
| InChI | InChI=1S/C21H18N4/c1-15-13-19(21-22-16(2)14-25(21)24-15)23-20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14H,1-2H3 |
| InChIKey | NJEYMAXUSZLMHI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|