About 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone
1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone (PubChem CID 171819875) has the molecular formula C24H21N3O
and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone |
| PubChem CID | 171819875 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone |
| SMILES | CC(=O)c1nc2c(cc1N=C(c1ccccc1)c1ccccc1)cc(C)n2C |
| InChI | InChI=1S/C24H21N3O/c1-16-14-20-15-21(22(17(2)28)26-24(20)27(16)3)25-23(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15H,1-3H3 |
| InChIKey | OKWDPNGPRUSGAD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone?
The IUPAC name of 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone (CID 171819875) is 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone.
What is the SMILES notation for 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone?
The canonical SMILES for 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone is CC(=O)c1nc2c(cc1N=C(c1ccccc1)c1ccccc1)cc(C)n2C.
What is the InChIKey of 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone?
The InChIKey is OKWDPNGPRUSGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O/c1-16-14-20-15-21(22(17(2)28)26-24(20)27(16)3)25-23(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15H,1-3H3.
What are the key properties of 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone?
1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone has a molecular weight of 367.45 g/mol, XLogP of 5.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(benzhydrylideneamino)-1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl]ethanone is sourced from PubChem (CID 171819875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).