C22H30FNO3Si — CID 177203284
3-fluoro-5-(methoxymethoxy)-4-[2-tri(propan-2-yl)silylethynyl]quinolin-7-ol (PubChem CID 177203284) has the molecular formula C22H30FNO3Si and a molecular weight of 403.57 g/mol. Its IUPAC name is 3-fluoro-5-(methoxymethoxy)-4-[2-tri(propan-2-yl)silylethynyl]quinolin-7-ol.
| Compound Name | 3-fluoro-5-(methoxymethoxy)-4-[2-tri(propan-2-yl)silylethynyl]quinolin-7-ol |
|---|---|
| PubChem CID | 177203284 |
| Molecular Formula | C22H30FNO3Si |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-fluoro-5-(methoxymethoxy)-4-[2-tri(propan-2-yl)silylethynyl]quinolin-7-ol |
| SMILES | COCOc1cc(O)cc2ncc(F)c(C#C[Si](C(C)C)(C(C)C)C(C)C)c12 |
| InChI | InChI=1S/C22H30FNO3Si/c1-14(2)28(15(3)4,16(5)6)9-8-18-19(23)12-24-20-10-17(25)11-21(22(18)20)27-13-26-7/h10-12,14-16,25H,13H2,1-7H3 |
| InChIKey | YMAVABXOXMGFTP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|