C12H18OS — CID 177208600
6-(4-methylpentyl)-2,3-dihydrothieno[3,4-b]furan (PubChem CID 177208600) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 6-(4-methylpentyl)-2,3-dihydrothieno[3,4-b]furan.
| Compound Name | 6-(4-methylpentyl)-2,3-dihydrothieno[3,4-b]furan |
|---|---|
| PubChem CID | 177208600 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 6-(4-methylpentyl)-2,3-dihydrothieno[3,4-b]furan |
| SMILES | CC(C)CCCc1scc2c1OCC2 |
| InChI | InChI=1S/C12H18OS/c1-9(2)4-3-5-11-12-10(8-14-11)6-7-13-12/h8-9H,3-7H2,1-2H3 |
| InChIKey | MSMKGKYHNZOMDT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |