About 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate
2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate (PubChem CID 177209466) has the molecular formula C22H25ClN2O3
and a molecular weight of 400.91 g/mol. Its IUPAC name is 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate.
Molecular Properties
| Compound Name | 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate |
| PubChem CID | 177209466 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(OC(=O)N1CCCN(C(=O)Cl)CC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-22(2,19-11-9-18(10-12-19)17-7-4-3-5-8-17)28-21(27)25-14-6-13-24(15-16-25)20(23)26/h3-5,7-12H,6,13-16H2,1-2H3 |
| InChIKey | JPVBWDAFKPLRDX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate?
The IUPAC name of 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate (CID 177209466) is 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate.
What is the SMILES notation for 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate?
The canonical SMILES for 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate is CC(C)(OC(=O)N1CCCN(C(=O)Cl)CC1)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate?
The InChIKey is JPVBWDAFKPLRDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25ClN2O3/c1-22(2,19-11-9-18(10-12-19)17-7-4-3-5-8-17)28-21(27)25-14-6-13-24(15-16-25)20(23)26/h3-5,7-12H,6,13-16H2,1-2H3.
What are the key properties of 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate?
2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate has a molecular weight of 400.91 g/mol, XLogP of 5.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenylphenyl)propan-2-yl 4-carbonochloridoyl-1,4-diazepane-1-carboxylate is sourced from PubChem (CID 177209466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).