C22H26O — CID 177209632
1-methylcyclohexa-1,3-diene;(2E)-3-methylidene-2-prop-2-enylidene-1-benzofuran;prop-1-ene (PubChem CID 177209632) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-methylcyclohexa-1,3-diene;(2E)-3-methylidene-2-prop-2-enylidene-1-benzofuran;prop-1-ene.
| Compound Name | 1-methylcyclohexa-1,3-diene;(2E)-3-methylidene-2-prop-2-enylidene-1-benzofuran;prop-1-ene |
|---|---|
| PubChem CID | 177209632 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1-methylcyclohexa-1,3-diene;(2E)-3-methylidene-2-prop-2-enylidene-1-benzofuran;prop-1-ene |
| SMILES | C=C/C=c1/oc2ccccc2c1=C.C=CC.CC1=CC=CCC1 |
| InChI | InChI=1S/C12H10O.C7H10.C3H6/c1-3-6-11-9(2)10-7-4-5-8-12(10)13-11;1-7-5-3-2-4-6-7;1-3-2/h3-8H,1-2H2;2-3,5H,4,6H2,1H3;3H,1H2,2H3/b11-6+;; |
| InChIKey | JSVQRYOONHDIQH-QVLKBJGCSA-N |
| XLogP | 5.28 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|