C20H14ClF3N4O — CID 177212916
4-[6-[2-[6-chloro-1-(difluoromethyl)-2,7-naphthyridin-4-yl]ethynyl]-5-fluoro-3-pyridinyl]morpholine (PubChem CID 177212916) has the molecular formula C20H14ClF3N4O and a molecular weight of 418.81 g/mol. Its IUPAC name is 4-[6-[2-[6-chloro-1-(difluoromethyl)-2,7-naphthyridin-4-yl]ethynyl]-5-fluoro-3-pyridinyl]morpholine.
| Compound Name | 4-[6-[2-[6-chloro-1-(difluoromethyl)-2,7-naphthyridin-4-yl]ethynyl]-5-fluoro-3-pyridinyl]morpholine |
|---|---|
| PubChem CID | 177212916 |
| Molecular Formula | C20H14ClF3N4O |
| Molecular Weight | 418.81 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 4-[6-[2-[6-chloro-1-(difluoromethyl)-2,7-naphthyridin-4-yl]ethynyl]-5-fluoro-3-pyridinyl]morpholine |
| SMILES | Fc1cc(N2CCOCC2)cnc1C#Cc1cnc(C(F)F)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C20H14ClF3N4O/c21-18-8-14-12(9-27-19(20(23)24)15(14)11-26-18)1-2-17-16(22)7-13(10-25-17)28-3-5-29-6-4-28/h7-11,20H,3-6H2 |
| InChIKey | SFTBNHVBEXBLIT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|