C24H30O — CID 177218836
(6R)-15-cyclohexyl-9-methyl-5-methylidenetetracyclo[10.4.0.02,4.06,11]hexadeca-1(12),9,13,15-tetraen-13-ol (PubChem CID 177218836) has the molecular formula C24H30O and a molecular weight of 334.50 g/mol. Its IUPAC name is (6R)-15-cyclohexyl-9-methyl-5-methylidenetetracyclo[10.4.0.02,4.06,11]hexadeca-1(12),9,13,15-tetraen-13-ol.
| Compound Name | (6R)-15-cyclohexyl-9-methyl-5-methylidenetetracyclo[10.4.0.02,4.06,11]hexadeca-1(12),9,13,15-tetraen-13-ol |
|---|---|
| PubChem CID | 177218836 |
| Molecular Formula | C24H30O |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (6R)-15-cyclohexyl-9-methyl-5-methylidenetetracyclo[10.4.0.02,4.06,11]hexadeca-1(12),9,13,15-tetraen-13-ol |
| SMILES | C=C1C2CC2c2cc(C3CCCCC3)cc(O)c2C2C=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C24H30O/c1-14-8-9-18-15(2)19-13-20(19)22-11-17(16-6-4-3-5-7-16)12-23(25)24(22)21(18)10-14/h10-12,16,18-21,25H,2-9,13H2,1H3/t18-,19?,20?,21?/m0/s1 |
| InChIKey | AXENEABOIHBSHF-PCMKAUBLSA-N |
| XLogP | 6.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|