C26H27NO4 — CID 177222127
N-[2,6-di(propan-2-yl)phenyl]-3-hydroxy-N-(3-hydroxybenzoyl)benzamide (PubChem CID 177222127) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-3-hydroxy-N-(3-hydroxybenzoyl)benzamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-3-hydroxy-N-(3-hydroxybenzoyl)benzamide |
|---|---|
| PubChem CID | 177222127 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-3-hydroxy-N-(3-hydroxybenzoyl)benzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1N(C(=O)c1cccc(O)c1)C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C26H27NO4/c1-16(2)22-12-7-13-23(17(3)4)24(22)27(25(30)18-8-5-10-20(28)14-18)26(31)19-9-6-11-21(29)15-19/h5-17,28-29H,1-4H3 |
| InChIKey | DLGJPJRLRJVDCR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|