C28H31NO4 — CID 177222105
N-(3,5-ditert-butylphenyl)-3-hydroxy-N-(3-hydroxybenzoyl)benzamide (PubChem CID 177222105) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-(3,5-ditert-butylphenyl)-3-hydroxy-N-(3-hydroxybenzoyl)benzamide.
| Compound Name | N-(3,5-ditert-butylphenyl)-3-hydroxy-N-(3-hydroxybenzoyl)benzamide |
|---|---|
| PubChem CID | 177222105 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | N-(3,5-ditert-butylphenyl)-3-hydroxy-N-(3-hydroxybenzoyl)benzamide |
| SMILES | CC(C)(C)c1cc(N(C(=O)c2cccc(O)c2)C(=O)c2cccc(O)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H31NO4/c1-27(2,3)20-15-21(28(4,5)6)17-22(16-20)29(25(32)18-9-7-11-23(30)13-18)26(33)19-10-8-12-24(31)14-19/h7-17,30-31H,1-6H3 |
| InChIKey | UPKASNWLSSEDAM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|