C14H25NO — CID 177223337
ethane;3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-methylpyrrolidine (PubChem CID 177223337) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-methylpyrrolidine.
| Compound Name | ethane;3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-methylpyrrolidine |
|---|---|
| PubChem CID | 177223337 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-methylpyrrolidine |
| SMILES | C=C/C(=C\C=C/C)OC1CCN(C)C1.CC |
| InChI | InChI=1S/C12H19NO.C2H6/c1-4-6-7-11(5-2)14-12-8-9-13(3)10-12;1-2/h4-7,12H,2,8-10H2,1,3H3;1-2H3/b6-4-,11-7+; |
| InChIKey | LAUHZXHDJWUBGJ-LAIAQJOMSA-N |
| XLogP | 3.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|