C21H31NO2 — CID 134576697
3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxyethyl]-3-methylpyrrolidine (PubChem CID 134576697) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxyethyl]-3-methylpyrrolidine.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxyethyl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 134576697 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxyethyl]-3-methylpyrrolidine |
| SMILES | C=C/C=C\C=C(/C)OCCN1CCC(C)(O/C(C=C)=C/C=C\C)C1 |
| InChI | InChI=1S/C21H31NO2/c1-6-9-11-12-19(4)23-17-16-22-15-14-21(5,18-22)24-20(8-3)13-10-7-2/h6-13H,1,3,14-18H2,2,4-5H3/b10-7-,11-9-,19-12+,20-13+ |
| InChIKey | IZCOXPBBUUYRHD-DUJPEHJDSA-N |
| XLogP | 4.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|