C11H21N3 — CID 177223375
(E,1Z)-1-(1-piperidin-1-ylethylimino)but-2-en-2-amine (PubChem CID 177223375) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (E,1Z)-1-(1-piperidin-1-ylethylimino)but-2-en-2-amine.
| Compound Name | (E,1Z)-1-(1-piperidin-1-ylethylimino)but-2-en-2-amine |
|---|---|
| PubChem CID | 177223375 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (E,1Z)-1-(1-piperidin-1-ylethylimino)but-2-en-2-amine |
| SMILES | C/C=C(N)\C=N/C(C)N1CCCCC1 |
| InChI | InChI=1S/C11H21N3/c1-3-11(12)9-13-10(2)14-7-5-4-6-8-14/h3,9-10H,4-8,12H2,1-2H3/b11-3+,13-9- |
| InChIKey | KRUJEIVTEPIWRX-XHUVJHOBSA-N |
| XLogP | 1.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|