C27H34N4O3 — CID 177234413
(2Z,3Z,5E)-5-[2-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]-3,6-dihydrooxazin-5-yl]-N,3-dimethyl-2-propylidenehepta-3,5-dienamide (PubChem CID 177234413) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is (2Z,3Z,5E)-5-[2-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]-3,6-dihydrooxazin-5-yl]-N,3-dimethyl-2-propylidenehepta-3,5-dienamide.
| Compound Name | (2Z,3Z,5E)-5-[2-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]-3,6-dihydrooxazin-5-yl]-N,3-dimethyl-2-propylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 177234413 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (2Z,3Z,5E)-5-[2-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]-3,6-dihydrooxazin-5-yl]-N,3-dimethyl-2-propylidenehepta-3,5-dienamide |
| SMILES | C/C=C(\C=C(C)/C(=C/CC)C(=O)NC)C1=CCN(Cc2cnc3cc(CC)c(=O)[nH]c3c2)OC1 |
| InChI | InChI=1S/C27H34N4O3/c1-6-9-23(27(33)28-5)18(4)12-20(7-2)22-10-11-31(34-17-22)16-19-13-25-24(29-15-19)14-21(8-3)26(32)30-25/h7,9-10,12-15H,6,8,11,16-17H2,1-5H3,(H,28,33)(H,30,32)/b18-12-,20-7+,23-9- |
| InChIKey | NVYKSZAIXFJIMG-VUPVVGTNSA-N |
| XLogP | 4.13 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|