C19H29N2OY- — CID 177234826
(1Z,3E,7E)-3,6-dimethyl-2-(oxan-4-yliminomethyl)undeca-1,3,5,7-tetraen-1-amine;yttrium (PubChem CID 177234826) has the molecular formula C19H29N2OY- and a molecular weight of 390.36 g/mol. Its IUPAC name is (1Z,3E,7E)-3,6-dimethyl-2-(oxan-4-yliminomethyl)undeca-1,3,5,7-tetraen-1-amine;yttrium.
| Compound Name | (1Z,3E,7E)-3,6-dimethyl-2-(oxan-4-yliminomethyl)undeca-1,3,5,7-tetraen-1-amine;yttrium |
|---|---|
| PubChem CID | 177234826 |
| Molecular Formula | C19H29N2OY- |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (1Z,3E,7E)-3,6-dimethyl-2-(oxan-4-yliminomethyl)undeca-1,3,5,7-tetraen-1-amine;yttrium |
| SMILES | CCC/C=C/C(C)=[C-]/C=C(C)/C(=C/N)/C=N/C1CCOCC1.[Y] |
| InChI | InChI=1S/C19H29N2O.Y/c1-4-5-6-7-16(2)8-9-17(3)18(14-20)15-21-19-10-12-22-13-11-19;/h6-7,9,14-15,19H,4-5,10-13,20H2,1-3H3;/q-1;/b7-6+,17-9+,18-14+,21-15+; |
| InChIKey | ZKJXBJOKMJOWCD-UVLYZXDTSA-N |
| XLogP | 4.13 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|