C7H13N3O — CID 163502502
1-(oxetan-3-ylimino)but-2-ene-2,3-diamine (PubChem CID 163502502) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 1-(oxetan-3-ylimino)but-2-ene-2,3-diamine.
| Compound Name | 1-(oxetan-3-ylimino)but-2-ene-2,3-diamine |
|---|---|
| PubChem CID | 163502502 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 1-(oxetan-3-ylimino)but-2-ene-2,3-diamine |
| SMILES | CC(N)=C(N)/C=N/C1COC1 |
| InChI | InChI=1S/C7H13N3O/c1-5(8)7(9)2-10-6-3-11-4-6/h2,6H,3-4,8-9H2,1H3/b7-5?,10-2+ |
| InChIKey | GNRQRRLPYWCOMS-JOCNWKIGSA-N |
| XLogP | -0.40 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|