About 1,3-dioxane;hept-3-en-2-one
1,3-dioxane;hept-3-en-2-one (PubChem CID 174422535) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1,3-dioxane;hept-3-en-2-one.
Molecular Properties
| Compound Name | 1,3-dioxane;hept-3-en-2-one |
| PubChem CID | 174422535 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1,3-dioxane;hept-3-en-2-one |
| SMILES | C1COCOC1.CCCC=CC(C)=O |
| InChI | InChI=1S/C7H12O.C4H8O2/c1-3-4-5-6-7(2)8;1-2-5-4-6-3-1/h5-6H,3-4H2,1-2H3;1-4H2 |
| InChIKey | BGFMQAICRROFHL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxane;hept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxane;hept-3-en-2-one?
The IUPAC name of 1,3-dioxane;hept-3-en-2-one (CID 174422535) is 1,3-dioxane;hept-3-en-2-one.
What is the SMILES notation for 1,3-dioxane;hept-3-en-2-one?
The canonical SMILES for 1,3-dioxane;hept-3-en-2-one is C1COCOC1.CCCC=CC(C)=O.
What is the InChIKey of 1,3-dioxane;hept-3-en-2-one?
The InChIKey is BGFMQAICRROFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C4H8O2/c1-3-4-5-6-7(2)8;1-2-5-4-6-3-1/h5-6H,3-4H2,1-2H3;1-4H2.
What are the key properties of 1,3-dioxane;hept-3-en-2-one?
1,3-dioxane;hept-3-en-2-one has a molecular weight of 200.28 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxane;hept-3-en-2-one is sourced from PubChem (CID 174422535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).